Online Database of Chemicals from Around the World
|
CAS#: 81995-79-1 Product: 1-(3-(4-(3,4-Dichlorophenyl)-1-Piperazinyl)Propyl)Theobromine No suppilers available for the product. |
| Name | 1-(3-(4-(3,4-Dichlorophenyl)-1-Piperazinyl)Propyl)Theobromine |
|---|---|
| Synonyms | 1-[3-[4-(3,4-Dichlorophenyl)Piperazin-1-Yl]Propyl]-3,7-Dimethyl-Purine-2,6-Dione; 1-[3-[4-(3,4-Dichlorophenyl)-1-Piperazinyl]Propyl]-3,7-Dimethylpurine-2,6-Dione; 1-[3-[4-(3,4-Dichlorophenyl)Piperazin-1-Yl]Propyl]-3,7-Dimethyl-Xanthine |
| Molecular Structure |  |
| Molecular Formula | C20H24Cl2N6O2 |
| Molecular Weight | 451.35 |
| CAS Registry Number | 81995-79-1 |
| SMILES | C1=NC2=C([N]1C)C(N(C(N2C)=O)CCCN3CCN(CC3)C4=CC=C(C(=C4)Cl)Cl)=O |
| InChI | 1S/C20H24Cl2N6O2/c1-24-13-23-18-17(24)19(29)28(20(30)25(18)2)7-3-6-26-8-10-27(11-9-26)14-4-5-15(21)16(22)12-14/h4-5,12-13H,3,6-11H2,1-2H3 |
| InChIKey | LFNYICHEDVBALH-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 669.189°C at 760 mmHg (Cal.) |
| Flash point | 358.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-(4-(3,4-Dichlorophenyl)-1-Piperazinyl)Propyl)Theobromine |