Online Database of Chemicals from Around the World
|
CAS#: 82040-51-5 Product: 4-Thioxylobiose No suppilers available for the product. |
| Name | 4-Thioxylobiose |
|---|---|
| Synonyms | (2R,3R,4R)-2,3,5-Trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-Trihydroxytetrahydropyran-2-Yl]Sulfanyl-Pentanal; (2R,3R,4R)-2,3,5-Trihydroxy-4-[[(2S,3R,4S,5R)-3,4,5-Trihydroxy-2-Tetrahydropyranyl]Thio]Pentanal; (2R,3R,4R)-2,3,5-Trihydroxy-4-[[(2S,3R,4S,5R)-3,4,5-Trihydroxytetrahydropyran-2-Yl]Thio]Valeraldehyde |
| Molecular Structure |  |
| Molecular Formula | C10H18O8S |
| Molecular Weight | 298.31 |
| CAS Registry Number | 82040-51-5 |
| SMILES | [C@@H]1([C@@H]([C@H]([C@@H](OC1)S[C@@H]([C@@H]([C@H](C=O)O)O)CO)O)O)O |
| InChI | 1S/C10H18O8S/c11-1-4(13)7(15)6(2-12)19-10-9(17)8(16)5(14)3-18-10/h1,4-10,12-17H,2-3H2/t4-,5+,6+,7+,8-,9+,10-/m0/s1 |
| InChIKey | NEGASMZGSNDEKT-RSZZQXBVSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.139°C at 760 mmHg (Cal.) |
| Flash point | 330.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Thioxylobiose |