Online Database of Chemicals from Around the World
|
CAS#: 82117-21-3 Product: 3-Chloro-7-methoxyisoquinoline No suppilers available for the product. |
| Name | 3-Chloro-7-methoxyisoquinoline |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.63 |
| CAS Registry Number | 82117-21-3 |
| SMILES | COC1=CC2=CN=C(C=C2C=C1)Cl |
| InChI | 1S/C10H8ClNO/c1-13-9-3-2-7-5-10(11)12-6-8(7)4-9/h2-6H,1H3 |
| InChIKey | WIINAUXTZQCUEC-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.0±22.0°C at 760 mmHg (Cal.) |
| Flash point | 155.2±22.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-7-methoxyisoquinoline |