Online Database of Chemicals from Around the World
|
CAS#: 82138-45-2 Product: 3-Amino-7-Methoxyacridine No suppilers available for the product. |
| Name | 3-Amino-7-Methoxyacridine |
|---|---|
| Synonyms | 7-Methoxy-3-Acridinamine; (7-Methoxyacridin-3-Yl)Amine; 3-A-7-Ma |
| Molecular Structure |  |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 |
| CAS Registry Number | 82138-45-2 |
| SMILES | C2=CC(=CC3=NC1=CC=C(C=C1C=C23)OC)N |
| InChI | 1S/C14H12N2O/c1-17-12-4-5-13-10(7-12)6-9-2-3-11(15)8-14(9)16-13/h2-8H,15H2,1H3 |
| InChIKey | XWJPZQWJVGGWOG-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.089°C at 760 mmHg (Cal.) |
| Flash point | 230.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-7-Methoxyacridine |