Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Mesityl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| Synonyms | 1-mesityl-1,4,5,6-tetrahydropyrimidine |
| Molecular Structure |  |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 |
| CAS Registry Number | 821779-94-6 |
| SMILES | Cc1cc(c(c(c1)C)N2CCCN=C2)C |
| InChI | 1S/C13H18N2/c1-10-7-11(2)13(12(3)8-10)15-6-4-5-14-9-15/h7-9H,4-6H2,1-3H3 |
| InChIKey | MMBZPNGOMSMALE-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.764°C at 760 mmHg (Cal.) |
| Flash point | 148.398°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Mesityl-1,4,5,6-tetrahydropyrimidine |