Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(4-Pyrimidinyl)benzenesulfonamide |
|---|---|
| Synonyms | N-(pyrimidin-4-yl)benzenesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.26 |
| CAS Registry Number | 82205-97-8 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=NC=NC=C2 |
| InChI | 1S/C10H9N3O2S/c14-16(15,9-4-2-1-3-5-9)13-10-6-7-11-8-12-10/h1-8H,(H,11,12,13) |
| InChIKey | KPWVGGNPTKQPST-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.2±37.0°C at 760 mmHg (Cal.) |
| Flash point | 208.6±26.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Pyrimidinyl)benzenesulfonamide |