|
CAS#: 82206-03-9 Product: beta-D-Glucopyranuronic Acid, 1-(1,1'-Biphenyl)-4-Carboxylate No suppilers available for the product. |
| Name | beta-D-Glucopyranuronic Acid, 1-(1,1'-Biphenyl)-4-Carboxylate |
|---|---|
| Synonyms | (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(4-Phenylbenzoyl)Oxy-Tetrahydropyran-2-Carboxylic Acid; (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-[Oxo-(4-Phenylphenyl)Methoxy]-2-Tetrahydropyrancarboxylic Acid; (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(4-Phenylphenyl)Carbonyloxy-Oxane-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 |
| CAS Registry Number | 82206-03-9 |
| SMILES | [C@@H]1([C@H](O)[C@@H](O)[C@H](O)[C@H](O1)C(=O)O)OC(C2=CC=C(C=C2)C3=CC=CC=C3)=O |
| InChI | 1S/C19H18O8/c20-13-14(21)16(17(23)24)26-19(15(13)22)27-18(25)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-16,19-22H,(H,23,24)/t13-,14-,15+,16-,19-/m0/s1 |
| InChIKey | AXZKYOZWGNTOIF-NAHJCDBISA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 654.815°C at 760 mmHg (Cal.) |
| Flash point | 237.746°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-D-Glucopyranuronic Acid, 1-(1,1'-Biphenyl)-4-Carboxylate |