Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl [(Z)-ethoxy-azoxy]acetate |
|---|---|
| Synonyms | (Z)-2-ethoxy-1-(2-methoxy-2-oxoethyl)diazene oxide |
| Molecular Structure | ![CAS#: 82385-94-2， Methyl [(Z)-ethoxy-azoxy]acetate](/moreStructures/82385-94-2.gif) |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 |
| CAS Registry Number | 82385-94-2 |
| SMILES | [O-]/[N+](=N\OCC)CC(=O)OC |
| InChI | 1S/C5H10N2O4/c1-3-11-6-7(9)4-5(8)10-2/h3-4H2,1-2H3/b7-6- |
| InChIKey | DTVQGSANPRCHOD-SREVYHEPSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.779°C at 760 mmHg (Cal.) |
| Flash point | 86.719°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl [(Z)-ethoxy-azoxy]acetate |