Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Oxotricyclo[3.3.0.03,7]octane-2-carbonyl chloride |
|---|---|
| Synonyms | 6-oxotricyclo[3.3.0.03,7]octane-2-carbonyl chloride |
| Molecular Structure | ![CAS#: 82431-43-4， 6-Oxotricyclo[3.3.0.0<sup>3,7</sup>]octane-2-carbonyl chloride](/moreStructures/82431-43-4.gif) |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 |
| CAS Registry Number | 82431-43-4 |
| SMILES | C1C2C3CC(C1C3=O)C2C(=O)Cl |
| InChI | 1S/C9H9ClO2/c10-9(12)7-3-1-5-4(7)2-6(3)8(5)11/h3-7H,1-2H2 |
| InChIKey | PHIYANSLBSWWTQ-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.79°C at 760 mmHg (Cal.) |
| Flash point | 118.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Oxotricyclo[3.3.0.03,7]octane-2-carbonyl chloride |