Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-(4-Nitrobenzyl)-5-Hydroxy-3H-Imidazole-4-Carboxamide |
|---|---|
| Synonyms | 3-(4-Nitrobenzyl)-5-Hydroxy-3H-Imidazole-4-Carboxamide |
| Molecular Structure |  |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.22 |
| CAS Registry Number | 82439-87-0 |
| SMILES | [O-][N+](=O)c1ccc(cc1)Cn1cnc(c1C(=O)N)O |
| InChI | 1S/C11H10N4O4/c12-10(16)9-11(17)13-6-14(9)5-7-1-3-8(4-2-7)15(18)19/h1-4,6,17H,5H2,(H2,12,16) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Nitrobenzyl)-5-Hydroxy-3H-Imidazole-4-Carboxamide |