Online Database of Chemicals from Around the World
|
CAS#: 82499-01-2 Product: 1H-Purine-6-Sulfonamide No suppilers available for the product. |
| Name | 1H-Purine-6-Sulfonamide |
|---|---|
| Synonyms | Nsc55466; Purine-6-Sulfonamide; 1H-Purine-6-Sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C5H5N5O2S |
| Molecular Weight | 199.19 |
| CAS Registry Number | 82499-01-2 |
| SMILES | C2=NC(=C1[NH]C=NC1=N2)[S](N)(=O)=O |
| InChI | 1S/C5H5N5O2S/c6-13(11,12)5-3-4(8-1-7-3)9-2-10-5/h1-2H,(H2,6,11,12)(H,7,8,9,10) |
| InChIKey | PCTGSUQZDBBLHN-UHFFFAOYSA-N |
| Density | 1.803g/cm3 (Cal.) |
|---|---|
| Boiling point | 658.385°C at 760 mmHg (Cal.) |
| Flash point | 351.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Purine-6-Sulfonamide |