Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 355-9920 | |||
|
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4-Methoxy-3-Nitrophenyl Phenyl Ketone |
|---|---|
| Synonyms | (4-Methoxy-3-Nitro-Phenyl)-Phenyl-Methanone; Eu-0033386 |
| Molecular Structure |  |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 |
| CAS Registry Number | 82571-94-6 |
| EINECS | 279-997-1 |
| SMILES | C1=C(C(=CC=C1C(C2=CC=CC=C2)=O)OC)[N+](=O)[O-] |
| InChI | 1S/C14H11NO4/c1-19-13-8-7-11(9-12(13)15(17)18)14(16)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | PDAVXJYHYUUFEY-UHFFFAOYSA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.659°C at 760 mmHg (Cal.) |
| Flash point | 195.594°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-3-Nitrophenyl Phenyl Ketone |