Online Database of Chemicals from Around the World
|
CAS#: 82650-28-0 Product: 3-Nitro-2-Pyridyl Disulfide No suppilers available for the product. |
| Name | 3-Nitro-2-Pyridyl Disulfide |
|---|---|
| Synonyms | 2-Methyldisulfanyl-3-Nitro-Pyridine; 3-Nitro-2-Pyridyl Disulfide; Npyssm |
| Molecular Structure |  |
| Molecular Formula | C6H6N2O2S2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 82650-28-0 |
| SMILES | C1=C([N+]([O-])=O)C(=NC=C1)SSC |
| InChI | 1S/C6H6N2O2S2/c1-11-12-6-5(8(9)10)3-2-4-7-6/h2-4H,1H3 |
| InChIKey | JJJBMWFBWHJKTG-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.087°C at 760 mmHg (Cal.) |
| Flash point | 141.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-2-Pyridyl Disulfide |