|
CAS#: 82756-71-6 Product: Methyl 3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate Hydrochloride No suppilers available for the product. |
| Name | Methyl 3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate Hydrochloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 82756-71-6 |
| SMILES | [C@H]1(OC2=C(NC1)C=CC=C2)C(OC)=O |
| InChI | 1S/C10H11NO3/c1-13-10(12)9-6-11-7-4-2-3-5-8(7)14-9/h2-5,9,11H,6H2,1H3/t9-/m1/s1 |
| InChIKey | HKOFHRITCCBESJ-SECBINFHSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.869°C at 760 mmHg (Cal.) |
| Flash point | 143.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxylate Hydrochloride |