Online Database of Chemicals from Around the World
|
CAS#: 82766-13-0 Product: Phenyl(2-Pyridyl)Methanonethiosemicarbazone No suppilers available for the product. |
| Name | Phenyl(2-Pyridyl)Methanonethiosemicarbazone |
|---|---|
| Synonyms | [[Phenyl-(2-Pyridyl)Methylene]Amino]Thiourea; [(Phenyl-Pyridin-2-Yl-Methylidene)Amino]Thiourea; Nsc143166 |
| Molecular Structure |  |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.32 |
| CAS Registry Number | 82766-13-0 |
| SMILES | C2=C(/C(=N/NC(=S)N)C1=CC=CC=N1)C=CC=C2 |
| InChI | 1S/C13H12N4S/c14-13(18)17-16-12(10-6-2-1-3-7-10)11-8-4-5-9-15-11/h1-9H,(H3,14,17,18)/b16-12- |
| InChIKey | DJSSWOPZTQTBBW-VBKFSLOCSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.862°C at 760 mmHg (Cal.) |
| Flash point | 218.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(2-Pyridyl)Methanonethiosemicarbazone |