Online Database of Chemicals from Around the World
|
CAS#: 830321-17-0 Product: 4-(2,6-Dimethylphenoxy)-2-methylaniline No suppilers available for the product. |
| Name | 4-(2,6-Dimethylphenoxy)-2-methylaniline |
|---|---|
| Synonyms | 4-(2,6-Dimethylphenoxy)-2-methylanilin; 4-(2,6-Dimethylphenoxy)-2-methylaniline; 4-(2,6-Diméthylphénoxy)-2-méthylaniline |
| Molecular Structure |  |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.30 |
| CAS Registry Number | 830321-17-0 |
| SMILES | Cc1cccc(c1Oc2ccc(c(c2)C)N)C |
| InChI | 1S/C15H17NO/c1-10-5-4-6-11(2)15(10)17-13-7-8-14(16)12(3)9-13/h4-9H,16H2,1-3H3 |
| InChIKey | FKUNGHWLRNHUHJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.2±30.0°C at 760 mmHg (Cal.) |
| Flash point | 159.0±17.8°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,6-Dimethylphenoxy)-2-methylaniline |