Online Database of Chemicals from Around the World
|
CAS#: 831171-05-2 Product: 4,6-Dimethoxy-2,3,5-trimethyl-1-benzofuran No suppilers available for the product. |
| Name | 4,6-Dimethoxy-2,3,5-trimethyl-1-benzofuran |
|---|---|
| Synonyms | 4,6-Dimethoxy-2,3,5-trimethyl-1-benzofuran; 4,6-Dimethoxy-2,3,5-trimethyl-1-benzofuran; 4,6-Diméthoxy-2,3,5-triméthyl-1-benzofurane |
| Molecular Structure |  |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26 |
| CAS Registry Number | 831171-05-2 |
| SMILES | Cc1c(oc2c1c(c(c(c2)OC)C)OC)C |
| InChI | 1S/C13H16O3/c1-7-9(3)16-11-6-10(14-4)8(2)13(15-5)12(7)11/h6H,1-5H3 |
| InChIKey | OEASDQXKPVVKEW-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.9±37.0°C at 760 mmHg (Cal.) |
| Flash point | 170.0±15.5°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethoxy-2,3,5-trimethyl-1-benzofuran |