Online Database of Chemicals from Around the World
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (610) 692-3026 | |||
 |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | 4-Methylphenanthrene |
|---|---|
| Synonyms | Nsc21046; Phenanthrene, 4-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 |
| CAS Registry Number | 832-64-4 |
| EINECS | 212-621-6 |
| SMILES | C1=CC2=C(C=C1)C=CC3=C2C(=CC=C3)C |
| InChI | 1S/C15H12/c1-11-5-4-7-13-10-9-12-6-2-3-8-14(12)15(11)13/h2-10H,1H3 |
| InChIKey | LOCGAKKLRVLQAM-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.522°C at 760 mmHg (Cal.) |
| Flash point | 157.52°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methylphenanthrene |