| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1'-[(1E)-1-Methyl-1,2-Ethenediyl]Bis-Benzene |
|---|---|
| Synonyms | [(E)-1-Phenylprop-1-En-2-Yl]Benzene; (1-Methyl-2-Phenyl-Vinyl)Benzene; [(E)-1-Methyl-2-Phenyl-Vinyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 833-81-8 |
| SMILES | C1=CC=CC=C1C(=C/C2=CC=CC=C2)/C |
| InChI | 1S/C15H14/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3/b13-12+ |
| InChIKey | OVZXISBUYCEVEV-OUKQBFOZSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.986 (Expl.) | |
| Melting point | 79-82°C (Expl.) |
| Boiling point | 282.5±10.0°C at 760 mmHg (Cal.) |
| Flash point | 124.5±9.7°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(1E)-1-Methyl-1,2-Ethenediyl]Bis-Benzene |