|
CAS#: 834-17-3 Product: 3-(Benzyloxy)Toluene No suppilers available for the product. |
| Name | 3-(Benzyloxy)Toluene |
|---|---|
| Synonyms | 1-(Benzyloxy)-3-Methyl-Benzene; M-(Benzyloxy)Toluene; Benzene, 1-Methyl-3-(Phenylmethoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| CAS Registry Number | 834-17-3 |
| EINECS | 212-635-2 |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC=C2)C |
| InChI | 1S/C14H14O/c1-12-6-5-9-14(10-12)15-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| InChIKey | FRQUHSBKTAMSDF-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.517°C at 760 mmHg (Cal.) |
| Flash point | 121.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Benzyloxy)Toluene |