Online Database of Chemicals from Around the World
|
CAS#: 83470-64-8 Product: 9-(3,4-Dihydroxybutyl)Guanine No suppilers available for the product. |
| Name | 9-(3,4-Dihydroxybutyl)Guanine |
|---|---|
| Synonyms | Aids189235; Dhbg-(R); Aids-186620 |
| Molecular Structure |  |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 |
| CAS Registry Number | 83470-64-8 |
| SMILES | [C@@H](CC[N]2C1=C(C(N=C(N1)N)=O)N=C2)(CO)O |
| InChI | 1S/C9H13N5O3/c10-9-12-7-6(8(17)13-9)11-4-14(7)2-1-5(16)3-15/h4-5,15-16H,1-3H2,(H3,10,12,13,17)/t5-/m1/s1 |
| InChIKey | QOVUZUCXPAZXDZ-RXMQYKEDSA-N |
| Density | 1.784g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.961°C at 760 mmHg (Cal.) |
| Flash point | 355.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(3,4-Dihydroxybutyl)Guanine |