Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(5-(Thiazol-4-Yl)-Furan-2-Yl)-Acetamide |
|---|---|
| Synonyms | N-(5-Thiazol-4-Yl-2-Furyl)Acetamide; N-[5-(4-Thiazolyl)-2-Furyl]Acetamide; N-[5-(1,3-Thiazol-4-Yl)Furan-2-Yl]Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.23 |
| CAS Registry Number | 83487-82-5 |
| SMILES | C1=C(NC(C)=O)OC(=C1)C2=CSC=N2 |
| InChI | 1S/C9H8N2O2S/c1-6(12)11-9-3-2-8(13-9)7-4-14-5-10-7/h2-5H,1H3,(H,11,12) |
| InChIKey | IBKLVDQIXAWUDL-UHFFFAOYSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.18°C at 760 mmHg (Cal.) |
| Flash point | 227.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(5-(Thiazol-4-Yl)-Furan-2-Yl)-Acetamide |