Online Database of Chemicals from Around the World
|
CAS#: 83498-24-2 Product: beta-Methyl-alpha-Methylenephenylbutyraldehyde No suppilers available for the product. |
| Name | beta-Methyl-alpha-Methylenephenylbutyraldehyde |
|---|---|
| Synonyms | 3-Methyl-2-Phenyl-Pent-4-Enal; Beta-Methyl-Alpha-Methylenephenylbutyraldehyde |
| Molecular Structure |  |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 |
| CAS Registry Number | 83498-24-2 |
| EINECS | 280-467-7 |
| SMILES | C1=C(C(C(C)C=C)C=O)C=CC=C1 |
| InChI | 1S/C12H14O/c1-3-10(2)12(9-13)11-7-5-4-6-8-11/h3-10,12H,1H2,2H3 |
| InChIKey | WLAMVMHDUAOOPR-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.591°C at 760 mmHg (Cal.) |
| Flash point | 112.879°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Methyl-alpha-Methylenephenylbutyraldehyde |