|
CAS#: 83567-05-9 Product: 2-{[3-(Ethylamino)phenyl]sulfonyl}ethanol No suppilers available for the product. |
| Name | 2-{[3-(Ethylamino)phenyl]sulfonyl}ethanol |
|---|---|
| Synonyms | 1-{[3-(ethylamino)phenyl]sulfonyl}ethan-2-ol; aniline, N-ethyl-3-(2-hydroxyethylsulfonyl)-; N-ETHYL-3-(β-HYDROXYETHYL SULFONYL)ANILINE |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 |
| CAS Registry Number | 83567-05-9 |
| SMILES | CCNc1cccc(c1)S(=O)(=O)CCO |
| InChI | 1S/C10H15NO3S/c1-2-11-9-4-3-5-10(8-9)15(13,14)7-6-12/h3-5,8,11-12H,2,6-7H2,1H3 |
| InChIKey | KRNJGMBSLSISNM-UHFFFAOYSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.994°C at 760 mmHg (Cal.) |
| Flash point | 240.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{[3-(Ethylamino)phenyl]sulfonyl}ethanol |