|
CAS#: 83665-31-0 Product: 2-(N-Phthalimido)Acetophenone No suppilers available for the product. |
| Name | 2-(N-Phthalimido)Acetophenone |
|---|---|
| Synonyms | 2-(2-Acetylphenyl)Isoindoline-1,3-Dione; 2-(2-Acetylphenyl)Isoindoline-1,3-Quinone; 2-(2-Ethanoylphenyl)Isoindole-1,3-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 83665-31-0 |
| SMILES | C1=CC=CC2=C1C(=O)N(C2=O)C3=CC=CC=C3C(=O)C |
| InChI | 1S/C16H11NO3/c1-10(18)11-6-4-5-9-14(11)17-15(19)12-7-2-3-8-13(12)16(17)20/h2-9H,1H3 |
| InChIKey | GWPXUNTVFUYEFS-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.309°C at 760 mmHg (Cal.) |
| Flash point | 212.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(N-Phthalimido)Acetophenone |