Online Database of Chemicals from Around the World
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (301) 961-1525 | |||
 |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 4-Chloro-6-Iodo-3-Nitrotoluene |
|---|---|
| Synonyms | 1-Chloro-5-Iodo-4-Methyl-2-Nitro-Benzene; 4-Chloro-6-Iodo-3-Nitrotoluene |
| Molecular Structure |  |
| Molecular Formula | C7H5ClINO2 |
| Molecular Weight | 297.48 |
| CAS Registry Number | 83706-53-0 |
| EINECS | 280-529-3 |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Cl)I)C |
| InChI | 1S/C7H5ClINO2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,1H3 |
| InChIKey | QKCJKTFOGQXDPE-UHFFFAOYSA-N |
| Density | 1.963g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.169°C at 760 mmHg (Cal.) |
| Flash point | 160.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-6-Iodo-3-Nitrotoluene |