Online Database of Chemicals from Around the World
|
CAS#: 83858-82-6 Product: Piperazinomycin No suppilers available for the product. |
| Name | Piperazinomycin |
|---|---|
| Synonyms | Piperazinomycin |
| Molecular Structure |  |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 |
| CAS Registry Number | 83858-82-6 |
| SMILES | [C@@H]13NC[C@@H](NC1)CC4=CC=C(OC2=C(O)C=CC(=C2)C3)C=C4 |
| InChI | 1S/C18H20N2O2/c21-17-6-3-13-8-15-11-19-14(10-20-15)7-12-1-4-16(5-2-12)22-18(17)9-13/h1-6,9,14-15,19-21H,7-8,10-11H2/t14-,15-/m0/s1 |
| InChIKey | UOLONRFQMXQQFB-GJZGRUSLSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.683°C at 760 mmHg (Cal.) |
| Flash point | 252.371°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Piperazinomycin |