| Bakul APIs | India | Inquire | ||
|---|---|---|---|---|
![]() | www.bakulpharma.com | |||
![]() | +91 (22) 6169-7900 | |||
![]() | sales@bakulpharma.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | 3-Methyl-4-phenyl-1-(p-tolylsulphonyl)piperidine-4-carbonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 |
| CAS Registry Number | 83863-65-4 |
| EC Number | 281-130-7 |
| SMILES | CC1CN(CCC1(C#N)C2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)C |
| Solubility | 1.233 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.619, Calc.* |
| Melting point | 213.29 °C |
| Boiling Point | 501.48 °C, 535.7±60.0 °C (760 mmHg), Calc.* |
| Flash Point | 277.8±32.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-phenyl-1-(p-tolylsulphonyl)piperidine-4-carbonitrile |