Online Database of Chemicals from Around the World
|
CAS#: 83898-38-8 Product: N,N-Bis(2-Chloropropyl)-p-Toluenesulphonamide No suppilers available for the product. |
| Name | N,N-Bis(2-Chloropropyl)-p-Toluenesulphonamide |
|---|---|
| Synonyms | N,N-Bis(2-Chloropropyl)-4-Methyl-Benzenesulfonamide; N,N-Bis(2-Chloropropyl)-P-Toluenesulphonamide |
| Molecular Structure |  |
| Molecular Formula | C13H19Cl2NO2S |
| Molecular Weight | 324.26 |
| CAS Registry Number | 83898-38-8 |
| EINECS | 281-247-3 |
| SMILES | C1=C([S](=O)(=O)N(CC(Cl)C)CC(Cl)C)C=CC(=C1)C |
| InChI | 1S/C13H19Cl2NO2S/c1-10-4-6-13(7-5-10)19(17,18)16(8-11(2)14)9-12(3)15/h4-7,11-12H,8-9H2,1-3H3 |
| InChIKey | FQOGAIVBWOJCFU-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.167°C at 760 mmHg (Cal.) |
| Flash point | 209.12°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Chloropropyl)-p-Toluenesulphonamide |