Online Database of Chemicals from Around the World
|
CAS#: 83929-69-5 Product: 2,2',3,3',5,5',6,6'-Octabromo-4-Phenoxy-1,1'-Biphenyl No suppilers available for the product. |
| Name | 2,2',3,3',5,5',6,6'-Octabromo-4-Phenoxy-1,1'-Biphenyl |
|---|---|
| Synonyms | 2,2',3,3',5,5',6,6'-Octabromo-4-Phenoxy-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C18H6Br8O |
| Molecular Weight | 877.48 |
| CAS Registry Number | 83929-69-5 |
| EINECS | 281-362-9 |
| SMILES | C1=C(Br)C(=C(C(=C1Br)Br)C3=C(Br)C(=C(OC2=CC=CC=C2)C(=C3Br)Br)Br)Br |
| InChI | 1S/C18H6Br8O/c19-8-6-9(20)13(22)10(12(8)21)11-14(23)16(25)18(17(26)15(11)24)27-7-4-2-1-3-5-7/h1-6H |
| InChIKey | ROAUFAHZXBZKFC-UHFFFAOYSA-N |
| Density | 2.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.239°C at 760 mmHg (Cal.) |
| Flash point | 232.036°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',3,3',5,5',6,6'-Octabromo-4-Phenoxy-1,1'-Biphenyl |