Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-(4-Methoxy-Phenyl)-Propylamine |
|---|---|
| Synonyms | [(1S)-1-(4-Methoxyphenyl)Propyl]Ammonium; Zinc03378495 |
| Molecular Structure |  |
| Molecular Formula | C10H16NO |
| Molecular Weight | 166.24 |
| CAS Registry Number | 83948-35-0 |
| SMILES | [C@@H]([NH3+])(C1=CC=C(OC)C=C1)CC |
| InChI | 1S/C10H15NO/c1-3-10(11)8-4-6-9(12-2)7-5-8/h4-7,10H,3,11H2,1-2H3/p+1/t10-/m0/s1 |
| InChIKey | WOEIOKRLEJXFEF-JTQLQIEISA-O |
| Boiling point | 258.128°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.389°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxy-Phenyl)-Propylamine |