Online Database of Chemicals from Around the World
|
CAS#: 83968-62-1 Product: 4-hydroxy-2(1H)-Quinolinone sodium salt (1:2) No suppilers available for the product. |
| Name | 4-hydroxy-2(1H)-Quinolinone sodium salt (1:2) |
|---|---|
| Synonyms | 4-hydroxy-2-quinolone, disodium salt |
| Molecular Structure |  |
| Molecular Formula | C9H7NNa2O2 |
| Molecular Weight | 207.14 |
| CAS Registry Number | 83968-62-1 |
| EINECS | 281-543-2 |
| SMILES | [Na+].[Na+].OC2=CC(=O)Nc1ccccc12 |
| InChI | 1S/C9H7NO2.2Na/c11-8-5-9(12)10-7-4-2-1-3-6(7)8;;/h1-5H,(H2,10,11,12);;/q;2*+1 |
| InChIKey | RWJXPVCCOPVEHM-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 4-hydroxy-2(1H)-Quinolinone sodium salt (1:2) |