Online Database of Chemicals from Around the World
|
CAS#: 84029-85-6 Product: 1-Methylcyclohex-4-Ene-1,2-Dicarboxylic Acid No suppilers available for the product. |
| Name | 1-Methylcyclohex-4-Ene-1,2-Dicarboxylic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 84029-85-6 |
| EINECS | 281-756-0 |
| SMILES | CC1(C(C(=O)O)CC=CC1)C(=O)O |
| InChI | 1S/C9H12O4/c1-9(8(12)13)5-3-2-4-6(9)7(10)11/h2-3,6H,4-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | IIOYAXLMGNWCQN-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.721°C at 760 mmHg (Cal.) |
| Flash point | 197.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methylcyclohex-4-Ene-1,2-Dicarboxylic Acid |