Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Simagchem Corporation | China | Inquire | ||
|---|---|---|---|---|
|
+86 13806087780 | |||
|
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | (Z,Z)-3-Hexenyl 2-Methyl-2-Butenoate |
|---|---|
| Synonyms | [(E)-Hex-3-Enyl] (E)-2-Methylbut-2-Enoate; 2-Methylbut-2-Enoic Acid Hex-3-Enyl Ester; (E)-2-Methylbut-2-Enoic Acid [(E)-Hex-3-Enyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 84060-80-0 |
| EINECS | 281-904-4 |
| SMILES | C(OC(C(=C/C)/C)=O)C\C=C\CC |
| InChI | 1S/C11H18O2/c1-4-6-7-8-9-13-11(12)10(3)5-2/h5-7H,4,8-9H2,1-3H3/b7-6+,10-5+ |
| InChIKey | JNWQKXUWZWKUAY-XYLIHAQWSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.303°C at 760 mmHg (Cal.) |
| Flash point | 106.221°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z,Z)-3-Hexenyl 2-Methyl-2-Butenoate |