Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,5-Diamino-2-(3,4-Dihydroxyphenyl)-4,8-Dihydroxy-9,10-Anthracenedione |
|---|---|
| Synonyms | 1,5-Diamino-2-(3,4-Dihydroxyphenyl)-4,8-Dihydroxy-Anthracene-9,10-Dione; 1,5-Diamino-2-(3,4-Dihydroxyphenyl)-4,8-Dihydroxy-9,10-Anthraquinone; 1,5-Diamino-2-(3,4-Dihydroxyphenyl)-4,8-Dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C20H14N2O6 |
| Molecular Weight | 378.34 |
| CAS Registry Number | 84100-90-3 |
| EINECS | 282-169-2 |
| SMILES | C1=C(C(=C3C(=C1O)C(=O)C2=C(N)C=CC(=C2C3=O)O)N)C4=CC(=C(O)C=C4)O |
| InChI | 1S/C20H14N2O6/c21-9-2-4-11(24)15-14(9)19(27)16-13(26)6-8(18(22)17(16)20(15)28)7-1-3-10(23)12(25)5-7/h1-6,23-26H,21-22H2 |
| InChIKey | PZFWXFIOPGAEJT-UHFFFAOYSA-N |
| Density | 1.699g/cm3 (Cal.) |
|---|---|
| Boiling point | 813.127°C at 760 mmHg (Cal.) |
| Flash point | 445.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diamino-2-(3,4-Dihydroxyphenyl)-4,8-Dihydroxy-9,10-Anthracenedione |