Online Database of Chemicals from Around the World
|
CAS#: 84145-21-1 Product: Allyl 3-Chloro-2,2,3,3-Tetrafluoropropionate No suppilers available for the product. |
| Name | Allyl 3-Chloro-2,2,3,3-Tetrafluoropropionate |
|---|---|
| Synonyms | Allyl 3-Chloro-2,2,3,3-Tetrafluoro-Propanoate; 3-Chloro-2,2,3,3-Tetrafluoropropanoic Acid Allyl Ester; 3-Chloro-2,2,3,3-Tetrafluoro-Propionic Acid Allyl Ester |
| Molecular Structure |  |
| Molecular Formula | C6H5ClF4O2 |
| Molecular Weight | 220.55 |
| CAS Registry Number | 84145-21-1 |
| EINECS | 282-246-0 |
| SMILES | C(OC(=O)C(F)(F)C(Cl)(F)F)C=C |
| InChI | 1S/C6H5ClF4O2/c1-2-3-13-4(12)5(8,9)6(7,10)11/h2H,1,3H2 |
| InChIKey | LLPBXFSEYUYFDS-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 163.133°C at 760 mmHg (Cal.) |
| Flash point | 56.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl 3-Chloro-2,2,3,3-Tetrafluoropropionate |