| Leap Chem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2022 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4,4,4-Trifluorobutylamine Hydrochloride 97 |
|---|---|
| Synonyms | 4,4,4-Trifluorobutylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9ClF3N |
| Molecular Weight | 163.57 |
| CAS Registry Number | 84153-82-2 |
| SMILES | [H+].C(C(F)(F)F)CCN.[Cl-] |
| InChI | 1S/C4H8F3N.ClH/c5-4(6,7)2-1-3-8;/h1-3,8H2;1H |
| InChIKey | QOTKGSVSGMIHGN-UHFFFAOYSA-N |
| Melting point | 180-186°C (Expl.) |
|---|---|
| Boiling point | 67.1°C at 760 mmHg (Cal.) |
| 92-94°C (Expl.) | |
| Flash point | 110°C (Expl.) |
| 3.6°C (Cal.) | |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4,4-Trifluorobutylamine Hydrochloride 97 |