|
CAS#: 84196-07-6 Product: Di(1,3-Dimethylbutyl) Hydrogen Phosphate No suppilers available for the product. |
| Name | Di(1,3-Dimethylbutyl) Hydrogen Phosphate |
|---|---|
| Synonyms | Bis(1,3-Dimethylbutyl) Hydrogen Phosphate; 2-Pentanol, 4-Methyl-, Hydrogen Phosphate; Di(1,3-Dimethylbutyl) Hydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H27O4P |
| Molecular Weight | 266.32 |
| CAS Registry Number | 84196-07-6 |
| EINECS | 282-415-9 |
| SMILES | C(C(C)C)C(O[P](OC(CC(C)C)C)(O)=O)C |
| InChI | 1S/C12H27O4P/c1-9(2)7-11(5)15-17(13,14)16-12(6)8-10(3)4/h9-12H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | YGTBMOOSDOYPEI-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.596°C at 760 mmHg (Cal.) |
| Flash point | 148.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(1,3-Dimethylbutyl) Hydrogen Phosphate |