Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N'-Nitrosonornicotine |
|---|---|
| Synonyms | 3-(1-Nitroso-2-Pyrrolidinyl)Pyridine; Ncgc00163363-01; (+-)-1'-Demethyl-1'-Nitrosonicotine |
| Molecular Structure |  |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 |
| CAS Registry Number | 84237-38-7 (16543-55-8;53759-22-1) |
| SMILES | C1=CC(=CN=C1)C2N(CCC2)N=O |
| InChI | 1S/C9H11N3O/c13-11-12-6-2-4-9(12)8-3-1-5-10-7-8/h1,3,5,7,9H,2,4,6H2 |
| InChIKey | XKABJYQDMJTNGQ-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Melting point | 47°C (Expl.) |
| Boiling point | 154°C (Expl.) |
| 369.483°C at 760 mmHg (Cal.) | |
| Flash point | 177.257°C (Cal.) |
| Safety Description | Safety glasses, gloves, good ventilation. Handle asa possible carcinogen. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N'-Nitrosonornicotine |