|
CAS#: 84244-15-5 Product: trans-5,6-Dihydro-5,6-Quinolinediol No suppilers available for the product. |
| Name | trans-5,6-Dihydro-5,6-Quinolinediol |
|---|---|
| Synonyms | (+-)-Trans-5,6-Dihydroxy-5,6-Dihydroquinoline; Ccris 4445; Trans-5,6-Dihydroxy-5,6-Dihydroquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 84244-15-5 (130536-38-8) |
| SMILES | [C@H]2(O)C1=C(N=CC=C1)C=C[C@@H]2O |
| InChI | 1S/C9H9NO2/c11-8-4-3-7-6(9(8)12)2-1-5-10-7/h1-5,8-9,11-12H/t8-,9-/m0/s1 |
| InChIKey | RXMLUIZBBRMXFQ-IUCAKERBSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.74°C at 760 mmHg (Cal.) |
| Flash point | 174.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-5,6-Dihydro-5,6-Quinolinediol |