Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Ethyl-4-Methylimidazole-5-Dithiocarboxylic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.29 |
| CAS Registry Number | 84255-42-5 |
| EINECS | 282-591-7 |
| SMILES | C(C1=NC(=C([NH]1)C)C(=S)S)C |
| InChI | 1S/C7H10N2S2/c1-3-5-8-4(2)6(9-5)7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | WQKQGRXNHYXVAH-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.887°C at 760 mmHg (Cal.) |
| Flash point | 190.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-4-Methylimidazole-5-Dithiocarboxylic Acid |