Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(1,2,3,4-Tetrahydrocyclopenta[b]indol-3-yl)ethanone |
|---|---|
| Synonyms | 1-(1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)ethanone |
| Molecular Structure | ![CAS#: 843667-17-4， 1-(1,2,3,4-Tetrahydrocyclopenta[b]indol-3-yl)ethanone](/moreStructures/843667-17-4.gif) |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| CAS Registry Number | 843667-17-4 |
| SMILES | CC(=O)C1CCc2c1[nH]c3c2cccc3 |
| InChI | 1S/C13H13NO/c1-8(15)9-6-7-11-10-4-2-3-5-12(10)14-13(9)11/h2-5,9,14H,6-7H2,1H3 |
| InChIKey | ZWYIZHYMDKEMAC-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.404°C at 760 mmHg (Cal.) |
| Flash point | 191.739°C (Cal.) |
| Refractive index | 1.66 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,2,3,4-Tetrahydrocyclopenta[b]indol-3-yl)ethanone |