Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Bide Pharmatech Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 4006-147-117 | |||
|
sales@bidepharmatech.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Name | Gardamide |
|---|---|
| Synonyms | N,2-Dimethyl-N-Phenyl-Butanamide; N,2-Dimethyl-N-Phenyl-Butyramide; Butanamide, N,2-Dimethyl-N-Phenyl- |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 |
| CAS Registry Number | 84434-18-4 |
| EINECS | 282-817-4 |
| SMILES | C1=C(N(C(C(CC)C)=O)C)C=CC=C1 |
| InChI | 1S/C12H17NO/c1-4-10(2)12(14)13(3)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3 |
| InChIKey | LNODIGSABOGNBQ-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.07°C at 760 mmHg (Cal.) |
| Flash point | 113.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Gardamide |