Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(Chlorocarbonyl)-3-methylphenyl acetate |
|---|---|
| Synonyms | 4-(chlorocarbonyl)-3-methylphenyl acetate |
| Molecular Structure |  |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 |
| CAS Registry Number | 84436-98-6 |
| SMILES | O=C(Oc1cc(c(cc1)C(Cl)=O)C)C |
| InChI | 1S/C10H9ClO3/c1-6-5-8(14-7(2)12)3-4-9(6)10(11)13/h3-5H,1-2H3 |
| InChIKey | IOYFOZCHGMPWSM-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.556°C at 760 mmHg (Cal.) |
| Flash point | 125.876°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Chlorocarbonyl)-3-methylphenyl acetate |