Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 9-Methyl-10-Nitroanthracene |
|---|---|
| Synonyms | 9-Methyl-10-Nitro-Anthracene; Anthracene, 9-Methyl-10-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 84457-22-7 |
| SMILES | C2=CC=CC3=C(C1=CC=CC=C1C(=C23)[N+]([O-])=O)C |
| InChI | 1S/C15H11NO2/c1-10-11-6-2-4-8-13(11)15(16(17)18)14-9-5-3-7-12(10)14/h2-9H,1H3 |
| InChIKey | FMIFGOKEBFQCGG-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.11°C at 760 mmHg (Cal.) |
| Flash point | 203.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methyl-10-Nitroanthracene |