Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2R)-2-(Anilinooxy)cyclopentanone |
|---|---|
| Synonyms | (R)-2-((phenylamino)oxy)cyclopentanone |
| Molecular Structure |  |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 844865-95-8 |
| SMILES | c1ccc(cc1)NO[C@@H]2CCCC2=O |
| InChI | 1S/C11H13NO2/c13-10-7-4-8-11(10)14-12-9-5-2-1-3-6-9/h1-3,5-6,11-12H,4,7-8H2/t11-/m1/s1 |
| InChIKey | WTKUIUHVCORUIS-LLVKDONJSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.942°C at 760 mmHg (Cal.) |
| Flash point | 139.434°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-(Anilinooxy)cyclopentanone |