Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | 1,2,3,5-Tetra-O-acetyl-beta-L-xylofuranose |
|---|---|
| Synonyms | 1,2,3,5-Tetra-O-acetyl-?-L-xylofuranose; 1,2,3,5-Tetra-O-acetyl-ß-L-xylofuranose; 1,2,3,5-Tetra-O-acetyl-β-L-xylofuranose |
| Molecular Structure |  |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 |
| CAS Registry Number | 844877-56-1 |
| SMILES | CC(=O)OC[C@H]1[C@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | 1S/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | IHNHAHWGVLXCCI-RNJOBUHISA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 168.5±27.9°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5-Tetra-O-acetyl-beta-L-xylofuranose |