| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | Ici 162,846 |
|---|---|
| Synonyms | 5-[3-[[Amino-(2,2,2-Trifluoroethylimino)Methyl]Amino]-1-Pyrazolyl]Pentanamide; 5-[3-[(N'-(2,2,2-Trifluoroethyl)Carbamimidoyl)Amino]Pyrazol-1-Yl]Valeramide; Ncgc00024812-02 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17F3N6O |
| Molecular Weight | 306.29 |
| CAS Registry Number | 84545-30-2 |
| SMILES | C1=CC(=N[N]1CCCCC(=O)N)NC(=NCC(F)(F)F)N |
| InChI | 1S/C11H17F3N6O/c12-11(13,14)7-17-10(16)18-9-4-6-20(19-9)5-2-1-3-8(15)21/h4,6H,1-3,5,7H2,(H2,15,21)(H3,16,17,18,19) |
| InChIKey | ALCSGJCIESECFD-UHFFFAOYSA-N |
| Density | 1.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.433°C at 760 mmHg (Cal.) |
| Flash point | 256.453°C (Cal.) |
| solubility | Soluble in ethanol and to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for Ici 162,846 |