Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-Carbamoylcyclobutanecarboxylic acid |
|---|---|
| Synonyms | (1R,2R)-2-carbamoylcyclobutanecarboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 |
| CAS Registry Number | 84585-79-5 |
| SMILES | C1C[C@H]([C@@H]1C(=O)N)C(=O)O |
| InChI | 1S/C6H9NO3/c7-5(8)3-1-2-4(3)6(9)10/h3-4H,1-2H2,(H2,7,8)(H,9,10)/t3-,4-/m1/s1 |
| InChIKey | VDJJUSIEPJADBA-QWWZWVQMSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.133°C at 760 mmHg (Cal.) |
| Flash point | 214.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Carbamoylcyclobutanecarboxylic acid |