| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | [2-Fluoro-4-(hydroxymethyl)phenoxy]acetic acid |
|---|---|
| Synonyms | 2-(2-fluoro-4-(hydroxymethyl)phenoxy)acetic acid; 2-Fluoro-4-(hydroxymethyl)-phenoxyacetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9FO4 |
| Molecular Weight | 200.16 |
| CAS Registry Number | 846046-30-8 |
| SMILES | C1=CC(=C(C=C1CO)F)OCC(=O)O |
| InChI | 1S/C9H9FO4/c10-7-3-6(4-11)1-2-8(7)14-5-9(12)13/h1-3,11H,4-5H2,(H,12,13) |
| InChIKey | POLRJFNLEUBWGX-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.7±32.0°C at 760 mmHg (Cal.) |
| Flash point | 184.0±25.1°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| (1) | Fredrik K. Wallner, Henrik A. Norberg, Annika I. Johansson, Mickael Mogemark and Mikael Elofsson. Solid-phase synthesis of serine-based glycosphingolipid analogues for preparation of glycoconjugate arrays, Org. Biomol. Chem., 2005, 3, 309. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [2-Fluoro-4-(hydroxymethyl)phenoxy]acetic acid |